C25H19F3N2O4 — CID 110593939
3-(4-ethoxyanilino)-4-phenyl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110593939) has the molecular formula C25H19F3N2O4 and a molecular weight of 468.43 g/mol. Its IUPAC name is 3-(4-ethoxyanilino)-4-phenyl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyanilino)-4-phenyl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110593939 |
| Molecular Formula | C25H19F3N2O4 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-(4-ethoxyanilino)-4-phenyl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CCOc1ccc(NC2=C(c3ccccc3)C(=O)N(c3ccc(OC(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H19F3N2O4/c1-2-33-19-12-8-17(9-13-19)29-22-21(16-6-4-3-5-7-16)23(31)30(24(22)32)18-10-14-20(15-11-18)34-25(26,27)28/h3-15,29H,2H2,1H3 |
| InChIKey | QHYSOYAQSNYTSU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|