C13H14N2O5 — CID 2117405
1-(3,4-diethoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 2117405) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(3,4-diethoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 2117405 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccc(N2C(=O)NC(=O)C2=O)cc1OCC |
| InChI | InChI=1S/C13H14N2O5/c1-3-19-9-6-5-8(7-10(9)20-4-2)15-12(17)11(16)14-13(15)18/h5-7H,3-4H2,1-2H3,(H,14,16,18) |
| InChIKey | KBXJFZCEJKOVTG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|