C16H21NO2 — CID 43394734
1-(3,4-diethoxyphenyl)-2,5-dimethylpyrrole (PubChem CID 43394734) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(3,4-diethoxyphenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 43394734 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-2,5-dimethylpyrrole |
| SMILES | CCOc1ccc(-n2c(C)ccc2C)cc1OCC |
| InChI | InChI=1S/C16H21NO2/c1-5-18-15-10-9-14(11-16(15)19-6-2)17-12(3)7-8-13(17)4/h7-11H,5-6H2,1-4H3 |
| InChIKey | YLCWWBWLEMROPZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|