C24H31N3O3S — CID 110553596
1-(3-butoxypropyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553596) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553596 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(c2cccs2)=C(N(CC)CCc2ccncc2)C1=O |
| InChI | InChI=1S/C24H31N3O3S/c1-3-5-16-30-17-7-14-27-23(28)21(20-8-6-18-31-20)22(24(27)29)26(4-2)15-11-19-9-12-25-13-10-19/h6,8-10,12-13,18H,3-5,7,11,14-17H2,1-2H3 |
| InChIKey | PISKTBHZFGZYMC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|