C25H33N3O3S — CID 110591146
1-(3-butoxypropyl)-3-[4-(diethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591146) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[4-(diethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-[4-(diethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591146 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[4-(diethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(Nc2ccc(N(CC)CC)cc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C25H33N3O3S/c1-4-7-16-31-17-9-15-28-24(29)22(21-10-8-18-32-21)23(25(28)30)26-19-11-13-20(14-12-19)27(5-2)6-3/h8,10-14,18,26H,4-7,9,15-17H2,1-3H3 |
| InChIKey | SSLZJYHWDBHMOG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|