C24H22FN3O2S — CID 110591504
3-[4-(diethylamino)anilino]-1-(2-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591504) has the molecular formula C24H22FN3O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-[4-(diethylamino)anilino]-1-(2-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-[4-(diethylamino)anilino]-1-(2-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591504 |
| Molecular Formula | C24H22FN3O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-[4-(diethylamino)anilino]-1-(2-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc(NC2=C(c3cccs3)C(=O)N(c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C24H22FN3O2S/c1-3-27(4-2)17-13-11-16(12-14-17)26-22-21(20-10-7-15-31-20)23(29)28(24(22)30)19-9-6-5-8-18(19)25/h5-15,26H,3-4H2,1-2H3 |
| InChIKey | LPRDCHGWMZYNLD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|