C25H25N3O3S — CID 110590404
1-[4-(diethylamino)phenyl]-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110590404) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590404 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(Nc3cccc(OC)c3)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-4-27(5-2)18-11-13-19(14-12-18)28-24(29)22(21-10-7-15-32-21)23(25(28)30)26-17-8-6-9-20(16-17)31-3/h6-16,26H,4-5H2,1-3H3 |
| InChIKey | BFJHHNPRDCFDGU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|