C25H31N3O5 — CID 110576502
3-[bis(2-methoxyethyl)amino]-4-(4-propoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110576502) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-4-(4-propoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-4-(4-propoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110576502 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-4-(4-propoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(N(CCOC)CCOC)C(=O)N(Cc3ccccn3)C2=O)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-4-15-33-21-10-8-19(9-11-21)22-23(27(13-16-31-2)14-17-32-3)25(30)28(24(22)29)18-20-7-5-6-12-26-20/h5-12H,4,13-18H2,1-3H3 |
| InChIKey | GVUSOBCDVHNTAB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|