C26H19F2N3O3 — CID 110563725
N-[4-[1-(3,4-difluorophenyl)-4-(2,3-dihydroindol-1-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110563725) has the molecular formula C26H19F2N3O3 and a molecular weight of 459.45 g/mol. Its IUPAC name is N-[4-[1-(3,4-difluorophenyl)-4-(2,3-dihydroindol-1-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-(3,4-difluorophenyl)-4-(2,3-dihydroindol-1-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110563725 |
| Molecular Formula | C26H19F2N3O3 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[4-[1-(3,4-difluorophenyl)-4-(2,3-dihydroindol-1-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(c3ccc(F)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H19F2N3O3/c1-15(32)29-18-8-6-17(7-9-18)23-24(30-13-12-16-4-2-3-5-22(16)30)26(34)31(25(23)33)19-10-11-20(27)21(28)14-19/h2-11,14H,12-13H2,1H3,(H,29,32) |
| InChIKey | AWAVJPWGKJAMPU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|