C25H19BrN2O2 — CID 110573315
1-(3-bromophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110573315) has the molecular formula C25H19BrN2O2 and a molecular weight of 459.34 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-bromophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573315 |
| Molecular Formula | C25H19BrN2O2 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(c3cccc(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H19BrN2O2/c1-16-9-11-18(12-10-16)22-23(27-14-13-17-5-2-3-8-21(17)27)25(30)28(24(22)29)20-7-4-6-19(26)15-20/h2-12,15H,13-14H2,1H3 |
| InChIKey | QHYHORNIRCUUST-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|