C25H29N3O4 — CID 110565444
3-(4-ethylpiperazin-1-yl)-4-(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrrole-2,5-dione (PubChem CID 110565444) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-4-(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-4-(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110565444 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-4-(2-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccccc3OC)C(=O)N(Cc3ccc(OC)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H29N3O4/c1-4-26-13-15-27(16-14-26)23-22(20-7-5-6-8-21(20)32-3)24(29)28(25(23)30)17-18-9-11-19(31-2)12-10-18/h5-12H,4,13-17H2,1-3H3 |
| InChIKey | PJFYAOVLFJWEKG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|