C27H26N4O3 — CID 110565731
1-benzyl-3-(2-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110565731) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-benzyl-3-(2-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(2-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110565731 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-benzyl-3-(2-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(N2CCN(c3ccccn3)CC2)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H26N4O3/c1-34-22-12-6-5-11-21(22)24-25(27(33)31(26(24)32)19-20-9-3-2-4-10-20)30-17-15-29(16-18-30)23-13-7-8-14-28-23/h2-14H,15-19H2,1H3 |
| InChIKey | VDBIXBXSOBRKFU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|