C25H29N5O3 — CID 110566042
1-cyclohexyl-3-(2-methoxyphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110566042) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-methoxyphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-cyclohexyl-3-(2-methoxyphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110566042 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-cyclohexyl-3-(2-methoxyphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(N2CCN(c3ncccn3)CC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C25H29N5O3/c1-33-20-11-6-5-10-19(20)21-22(24(32)30(23(21)31)18-8-3-2-4-9-18)28-14-16-29(17-15-28)25-26-12-7-13-27-25/h5-7,10-13,18H,2-4,8-9,14-17H2,1H3 |
| InChIKey | GNEXJZOSCSDKKU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|