C22H23NO3S — CID 110566312
3-benzylsulfanyl-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 110566312) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110566312 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-benzylsulfanyl-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(SCc2ccccc2)C(=O)N(CC(C)C)C1=O |
| InChI | InChI=1S/C22H23NO3S/c1-15(2)13-23-21(24)19(17-11-7-8-12-18(17)26-3)20(22(23)25)27-14-16-9-5-4-6-10-16/h4-12,15H,13-14H2,1-3H3 |
| InChIKey | GFTHMVGGYNMCQT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|