C17H21NO2S2 — CID 11056787
(E,3R)-3-hydroxy-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one (PubChem CID 11056787) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is (E,3R)-3-hydroxy-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one.
| Compound Name | (E,3R)-3-hydroxy-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 11056787 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (E,3R)-3-hydroxy-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one |
| SMILES | CC(C)[C@H]1CSC(=S)N1C(=O)C[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H21NO2S2/c1-12(2)15-11-22-17(21)18(15)16(20)10-14(19)9-8-13-6-4-3-5-7-13/h3-9,12,14-15,19H,10-11H2,1-2H3/b9-8+/t14-,15+/m0/s1 |
| InChIKey | IKCOVRIKOGAUIT-MATWNZDUSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|