C16H19NO2S2 — CID 11544297
(2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methylpent-4-en-1-one (PubChem CID 11544297) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methylpent-4-en-1-one.
| Compound Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methylpent-4-en-1-one |
|---|---|
| PubChem CID | 11544297 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methylpent-4-en-1-one |
| SMILES | C=C[C@@H](O)[C@H](C)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO2S2/c1-3-14(18)11(2)15(19)17-13(10-21-16(17)20)9-12-7-5-4-6-8-12/h3-8,11,13-14,18H,1,9-10H2,2H3/t11-,13-,14+/m0/s1 |
| InChIKey | KIZMKJHUAPBIHU-FPMFFAJLSA-N |
| XLogP | 2.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|