C19H18ClN3O3 — CID 110569436
3-(4-chlorophenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione (PubChem CID 110569436) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569436 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
| SMILES | CN(CCO)C1=C(c2ccc(Cl)cc2)C(=O)N(Cc2cccnc2)C1=O |
| InChI | InChI=1S/C19H18ClN3O3/c1-22(9-10-24)17-16(14-4-6-15(20)7-5-14)18(25)23(19(17)26)12-13-3-2-8-21-11-13/h2-8,11,24H,9-10,12H2,1H3 |
| InChIKey | RIPRQOFCNDUPGA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|