C15H16ClNO3S — CID 110569741
3-(4-chlorophenyl)-4-ethylsulfanyl-1-(2-methoxyethyl)pyrrole-2,5-dione (PubChem CID 110569741) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-ethylsulfanyl-1-(2-methoxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-ethylsulfanyl-1-(2-methoxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569741 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-ethylsulfanyl-1-(2-methoxyethyl)pyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccc(Cl)cc2)C(=O)N(CCOC)C1=O |
| InChI | InChI=1S/C15H16ClNO3S/c1-3-21-13-12(10-4-6-11(16)7-5-10)14(18)17(15(13)19)8-9-20-2/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | OUXPSBBNVNQBSG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|