C28H32N4O2 — CID 110571676
1-[2-(1H-indol-3-yl)ethyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110571676) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110571676 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N(C)C3CCN(C)CC3)C(=O)N(CCc3c[nH]c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-19-8-10-20(11-9-19)25-26(31(3)22-13-15-30(2)16-14-22)28(34)32(27(25)33)17-12-21-18-29-24-7-5-4-6-23(21)24/h4-11,18,22,29H,12-17H2,1-3H3 |
| InChIKey | FQSPFUWRMLXJDW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|