C26H28N4O3 — CID 110555707
1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110555707) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555707 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCN(C)CC3)C(=O)N(CCc3c[nH]c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-28-13-15-29(16-14-28)24-23(18-7-9-20(33-2)10-8-18)25(31)30(26(24)32)12-11-19-17-27-22-6-4-3-5-21(19)22/h3-10,17,27H,11-16H2,1-2H3 |
| InChIKey | XGVSRUUNYRYILA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|