C27H33N3O3 — CID 110574287
3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)-1-(2-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110574287) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)-1-(2-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)-1-(2-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110574287 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-[methyl-(1-methylpiperidin-4-yl)amino]-4-(4-methylphenyl)-1-(2-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccccc1N1C(=O)C(c2ccc(C)cc2)=C(N(C)C2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C27H33N3O3/c1-5-18-33-23-9-7-6-8-22(23)30-26(31)24(20-12-10-19(2)11-13-20)25(27(30)32)29(4)21-14-16-28(3)17-15-21/h6-13,21H,5,14-18H2,1-4H3 |
| InChIKey | DMZYSSNCLORXON-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|