C24H35N3O3 — CID 110577030
3-[methyl-(1-methylpiperidin-4-yl)amino]-1-(2-methylpropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110577030) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 3-[methyl-(1-methylpiperidin-4-yl)amino]-1-(2-methylpropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[methyl-(1-methylpiperidin-4-yl)amino]-1-(2-methylpropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110577030 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 3-[methyl-(1-methylpiperidin-4-yl)amino]-1-(2-methylpropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(N(C)C3CCN(C)CC3)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H35N3O3/c1-6-15-30-20-9-7-18(8-10-20)21-22(24(29)27(23(21)28)16-17(2)3)26(5)19-11-13-25(4)14-12-19/h7-10,17,19H,6,11-16H2,1-5H3 |
| InChIKey | JQKLRBUDOXSWON-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|