C20H26N2O4 — CID 110575238
3-(2,6-dimethylmorpholin-4-yl)-1-methyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110575238) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-1-methyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-1-methyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575238 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-1-methyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | CC(C)Oc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-12(2)25-16-8-6-15(7-9-16)17-18(20(24)21(5)19(17)23)22-10-13(3)26-14(4)11-22/h6-9,12-14H,10-11H2,1-5H3 |
| InChIKey | ULMNYPVRVZCZQZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|