C21H30N6O — CID 11058062
2,9-bis[3-(dimethylamino)propyl]-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene-5-carbaldehyde (PubChem CID 11058062) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is 2,9-bis[3-(dimethylamino)propyl]-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene-5-carbaldehyde.
| Compound Name | 2,9-bis[3-(dimethylamino)propyl]-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene-5-carbaldehyde |
|---|---|
| PubChem CID | 11058062 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 2,9-bis[3-(dimethylamino)propyl]-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene-5-carbaldehyde |
| SMILES | CN(C)CCCN1c2cccnc2N(CCCN(C)C)c2nc(C=O)ccc21 |
| InChI | InChI=1S/C21H30N6O/c1-24(2)12-6-14-26-18-8-5-11-22-20(18)27(15-7-13-25(3)4)21-19(26)10-9-17(16-28)23-21/h5,8-11,16H,6-7,12-15H2,1-4H3 |
| InChIKey | YBAPCUSDKFMAHG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|