C27H27ClN4O4 — CID 70491500
but-2-enedioic acid;3-(8-chloro-6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)-N,N-dimethylpropan-1-amine (PubChem CID 70491500) has the molecular formula C27H27ClN4O4 and a molecular weight of 506.99 g/mol. Its IUPAC name is but-2-enedioic acid;3-(8-chloro-6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | but-2-enedioic acid;3-(8-chloro-6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 70491500 |
| Molecular Formula | C27H27ClN4O4 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | but-2-enedioic acid;3-(8-chloro-6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCN1c2ccc(Cl)cc2C(c2ccccc2)=Nc2cccnc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H23ClN4.C4H4O4/c1-27(2)14-7-15-28-21-12-11-18(24)16-19(21)22(17-8-4-3-5-9-17)26-20-10-6-13-25-23(20)28;5-3(6)1-2-4(7)8/h3-6,8-13,16H,7,14-15H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | XEUILKFHIRSEIU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|