C30H32N4O4 — CID 15586673
(E)-but-2-enedioic acid;6-phenyl-11-(3-piperidin-1-ylpropyl)pyrido[2,3-b][1,4]benzodiazepine (PubChem CID 15586673) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;6-phenyl-11-(3-piperidin-1-ylpropyl)pyrido[2,3-b][1,4]benzodiazepine.
| Compound Name | (E)-but-2-enedioic acid;6-phenyl-11-(3-piperidin-1-ylpropyl)pyrido[2,3-b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 15586673 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (E)-but-2-enedioic acid;6-phenyl-11-(3-piperidin-1-ylpropyl)pyrido[2,3-b][1,4]benzodiazepine |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(C2=Nc3cccnc3N(CCCN3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H28N4.C4H4O4/c1-3-11-21(12-4-1)25-22-13-5-6-15-24(22)30(26-23(28-25)14-9-16-27-26)20-10-19-29-17-7-2-8-18-29;5-3(6)1-2-4(7)8/h1,3-6,9,11-16H,2,7-8,10,17-20H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FCZQQAMYHIOTDL-WLHGVMLRSA-N |
| XLogP | 5.29 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|