C22H42O3Si — CID 11058067
(1R,4S)-4-[(E)-4-[(2-methylpropan-2-yl)oxy]-1-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclopent-2-en-1-ol (PubChem CID 11058067) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (1R,4S)-4-[(E)-4-[(2-methylpropan-2-yl)oxy]-1-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclopent-2-en-1-ol.
| Compound Name | (1R,4S)-4-[(E)-4-[(2-methylpropan-2-yl)oxy]-1-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11058067 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (1R,4S)-4-[(E)-4-[(2-methylpropan-2-yl)oxy]-1-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclopent-2-en-1-ol |
| SMILES | CC(C)[Si](OC/C(=C/COC(C)(C)C)[C@@H]1C=C[C@H](O)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-16(2)26(17(3)4,18(5)6)25-15-20(12-13-24-22(7,8)9)19-10-11-21(23)14-19/h10-12,16-19,21,23H,13-15H2,1-9H3/b20-12-/t19-,21+/m1/s1 |
| InChIKey | VXVQNEYRKYZMBW-YRCZSLCMSA-N |
| XLogP | 5.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|