C28H60O6Si — CID 159588131
(E,2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-6-ene-1,5-diol;methane;(E,2S,3S,4S,5R)-3-methoxy-2,4-dimethyloct-6-ene-1,5-diol (PubChem CID 159588131) has the molecular formula C28H60O6Si and a molecular weight of 520.87 g/mol. Its IUPAC name is (E,2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-6-ene-1,5-diol;methane;(E,2S,3S,4S,5R)-3-methoxy-2,4-dimethyloct-6-ene-1,5-diol.
| Compound Name | (E,2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-6-ene-1,5-diol;methane;(E,2S,3S,4S,5R)-3-methoxy-2,4-dimethyloct-6-ene-1,5-diol |
|---|---|
| PubChem CID | 159588131 |
| Molecular Formula | C28H60O6Si |
| Molecular Weight | 520.87 g/mol |
| Exact Mass | 520.42 |
| IUPAC Name | (E,2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyloct-6-ene-1,5-diol;methane;(E,2S,3S,4S,5R)-3-methoxy-2,4-dimethyloct-6-ene-1,5-diol |
| SMILES | C.C/C=C/[C@@H](O)[C@H](C)[C@@H](OC)[C@@H](C)CO.C/C=C/[C@@H](O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C16H34O3Si.C11H22O3.CH4/c1-9-10-14(18)13(3)15(12(2)11-17)19-20(7,8)16(4,5)6;1-5-6-10(13)9(3)11(14-4)8(2)7-12;/h9-10,12-15,17-18H,11H2,1-8H3;5-6,8-13H,7H2,1-4H3;1H4/b10-9+;6-5+;/t12-,13-,14+,15-;8-,9-,10+,11-;/m00./s1 |
| InChIKey | MJWSGVWIUWRODI-DNPSFOKHSA-N |
| XLogP | 5.42 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|