C18H12F3NO5 — CID 110581547
3-hydroxy-4-(2-methoxyphenyl)-1-[3-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110581547) has the molecular formula C18H12F3NO5 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-hydroxy-4-(2-methoxyphenyl)-1-[3-(trifluoromethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-hydroxy-4-(2-methoxyphenyl)-1-[3-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581547 |
| Molecular Formula | C18H12F3NO5 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-hydroxy-4-(2-methoxyphenyl)-1-[3-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(O)C(=O)N(c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H12F3NO5/c1-26-13-8-3-2-7-12(13)14-15(23)17(25)22(16(14)24)10-5-4-6-11(9-10)27-18(19,20)21/h2-9,23H,1H3 |
| InChIKey | YSENPGLKPUVWNY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|