C23H15Cl2N3O4 — CID 110585822
3-(5-chloro-2-methylanilino)-1-(2-chlorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 110585822) has the molecular formula C23H15Cl2N3O4 and a molecular weight of 468.30 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)-1-(2-chlorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-chloro-2-methylanilino)-1-(2-chlorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110585822 |
| Molecular Formula | C23H15Cl2N3O4 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)-1-(2-chlorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(Cl)cc1NC1=C(c2ccc([N+](=O)[O-])cc2)C(=O)N(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C23H15Cl2N3O4/c1-13-6-9-15(24)12-18(13)26-21-20(14-7-10-16(11-8-14)28(31)32)22(29)27(23(21)30)19-5-3-2-4-17(19)25/h2-12,26H,1H3 |
| InChIKey | JNDXCHMNHVHFIR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|