C26H32N2O5 — CID 110588032
3-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-(3-propoxyanilino)pyrrole-2,5-dione (PubChem CID 110588032) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-(3-propoxyanilino)pyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-(3-propoxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588032 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-(3-propoxyanilino)pyrrole-2,5-dione |
| SMILES | CCCOc1cccc(NC2=C(c3ccc(OCC)cc3)C(=O)N(CCCOCC)C2=O)c1 |
| InChI | InChI=1S/C26H32N2O5/c1-4-16-33-22-10-7-9-20(18-22)27-24-23(19-11-13-21(14-12-19)32-6-3)25(29)28(26(24)30)15-8-17-31-5-2/h7,9-14,18,27H,4-6,8,15-17H2,1-3H3 |
| InChIKey | CHMOCNPRDISZHY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|