C25H28N4O4 — CID 11059383
ethyl (E)-3-[4-cyano-2-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]phenyl]prop-2-enoate (PubChem CID 11059383) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is ethyl (E)-3-[4-cyano-2-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-cyano-2-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11059383 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | ethyl (E)-3-[4-cyano-2-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(C#N)cc1OCCNC(=O)C1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C25H28N4O4/c1-2-32-24(30)6-5-20-4-3-19(18-26)17-23(20)33-16-13-28-25(31)21-9-14-29(15-10-21)22-7-11-27-12-8-22/h3-8,11-12,17,21H,2,9-10,13-16H2,1H3,(H,28,31)/b6-5+ |
| InChIKey | AZGWTXQCWZBQAX-AATRIKPKSA-N |
| XLogP | 2.94 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|