C25H27N5O4 — CID 22631379
(E)-3-[1-amino-7-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]isoquinolin-6-yl]prop-2-enoic acid (PubChem CID 22631379) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is (E)-3-[1-amino-7-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]isoquinolin-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-amino-7-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]isoquinolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22631379 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (E)-3-[1-amino-7-[2-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]ethoxy]isoquinolin-6-yl]prop-2-enoic acid |
| SMILES | Nc1nccc2cc(/C=C/C(=O)O)c(OCCNC(=O)C3CCN(c4ccncc4)CC3)cc12 |
| InChI | InChI=1S/C25H27N5O4/c26-24-21-16-22(19(1-2-23(31)32)15-18(21)3-10-28-24)34-14-11-29-25(33)17-6-12-30(13-7-17)20-4-8-27-9-5-20/h1-5,8-10,15-17H,6-7,11-14H2,(H2,26,28)(H,29,33)(H,31,32)/b2-1+ |
| InChIKey | GBIWFVNZPCYQBG-OWOJBTEDSA-N |
| XLogP | 2.72 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|