C24H30N4O5 — CID 174387508
phenylmethoxycarbonylamino 5-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]pentanoate (PubChem CID 174387508) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is phenylmethoxycarbonylamino 5-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]pentanoate.
| Compound Name | phenylmethoxycarbonylamino 5-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 174387508 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | phenylmethoxycarbonylamino 5-[(1-pyridin-4-ylpiperidine-4-carbonyl)amino]pentanoate |
| SMILES | O=C(CCCCNC(=O)C1CCN(c2ccncc2)CC1)ONC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N4O5/c29-22(33-27-24(31)32-18-19-6-2-1-3-7-19)8-4-5-13-26-23(30)20-11-16-28(17-12-20)21-9-14-25-15-10-21/h1-3,6-7,9-10,14-15,20H,4-5,8,11-13,16-18H2,(H,26,30)(H,27,31) |
| InChIKey | NFBWKGLHQFMTGJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|