C27H37NO5Si — CID 11059953
methyl (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate (PubChem CID 11059953) has the molecular formula C27H37NO5Si and a molecular weight of 483.68 g/mol. Its IUPAC name is methyl (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate.
| Compound Name | methyl (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 11059953 |
| Molecular Formula | C27H37NO5Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | methyl (E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H37NO5Si/c1-26(2,3)33-25(30)28-21(18-19-24(29)31-7)20-32-34(27(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-19,21H,20H2,1-7H3,(H,28,30)/b19-18+/t21-/m1/s1 |
| InChIKey | DIDNGOZXJCUDMO-XDSRXIPYSA-N |
| XLogP | 4.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|