C16H19N3O5S2 — CID 110601397
N-[3-[2-(benzenesulfonamido)ethylsulfonylamino]phenyl]acetamide (PubChem CID 110601397) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[3-[2-(benzenesulfonamido)ethylsulfonylamino]phenyl]acetamide.
| Compound Name | N-[3-[2-(benzenesulfonamido)ethylsulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 110601397 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[3-[2-(benzenesulfonamido)ethylsulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NS(=O)(=O)CCNS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H19N3O5S2/c1-13(20)18-14-6-5-7-15(12-14)19-25(21,22)11-10-17-26(23,24)16-8-3-2-4-9-16/h2-9,12,17,19H,10-11H2,1H3,(H,18,20) |
| InChIKey | USJRZBVAEKYSPB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |