C16H19N3O5S2 — CID 110408312
N-[4-[2-(phenylsulfamoyl)ethylsulfamoyl]phenyl]acetamide (PubChem CID 110408312) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[4-[2-(phenylsulfamoyl)ethylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(phenylsulfamoyl)ethylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 110408312 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[4-[2-(phenylsulfamoyl)ethylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCS(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19N3O5S2/c1-13(20)18-14-7-9-16(10-8-14)26(23,24)17-11-12-25(21,22)19-15-5-3-2-4-6-15/h2-10,17,19H,11-12H2,1H3,(H,18,20) |
| InChIKey | SHFRNNXIGZIXCE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |