C20H22N2O4 — CID 110606337
N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-(2-methylphenyl)butanamide (PubChem CID 110606337) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-(2-methylphenyl)butanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 110606337 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-(2-methylphenyl)butanamide |
| SMILES | Cc1ccccc1CCCC(=O)NCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H22N2O4/c1-14-5-2-3-6-15(14)7-4-8-19(23)21-12-20(24)22-16-9-10-17-18(11-16)26-13-25-17/h2-3,5-6,9-11H,4,7-8,12-13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | JJFNEIOZIALMIS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |