C19H22N2O4S — CID 110615511
N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-5-thiophen-2-ylpentanamide (PubChem CID 110615511) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 110615511 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-5-thiophen-2-ylpentanamide |
| SMILES | O=C(CCCCc1cccs1)NCC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H22N2O4S/c22-18(6-2-1-4-15-5-3-11-26-15)20-13-19(23)21-14-7-8-16-17(12-14)25-10-9-24-16/h3,5,7-8,11-12H,1-2,4,6,9-10,13H2,(H,20,22)(H,21,23) |
| InChIKey | BVDSDWQBBPEZKL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|