C18H12F2N2O3 — CID 110607516
7-fluoro-N-[2-(4-fluorophenyl)-2-oxoethyl]-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 110607516) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is 7-fluoro-N-[2-(4-fluorophenyl)-2-oxoethyl]-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 7-fluoro-N-[2-(4-fluorophenyl)-2-oxoethyl]-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110607516 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 7-fluoro-N-[2-(4-fluorophenyl)-2-oxoethyl]-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(CNC(=O)c1cc2ccc(F)cc2[nH]c1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12F2N2O3/c19-12-4-1-10(2-5-12)16(23)9-21-17(24)14-7-11-3-6-13(20)8-15(11)22-18(14)25/h1-8H,9H2,(H,21,24)(H,22,25) |
| InChIKey | SXYPXNVIXMPURL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |