C18H15FN2O4 — CID 110632933
7-fluoro-2-oxo-N-(2-phenoxyethoxy)-1H-quinoline-3-carboxamide (PubChem CID 110632933) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is 7-fluoro-2-oxo-N-(2-phenoxyethoxy)-1H-quinoline-3-carboxamide.
| Compound Name | 7-fluoro-2-oxo-N-(2-phenoxyethoxy)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110632933 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 7-fluoro-2-oxo-N-(2-phenoxyethoxy)-1H-quinoline-3-carboxamide |
| SMILES | O=C(NOCCOc1ccccc1)c1cc2ccc(F)cc2[nH]c1=O |
| InChI | InChI=1S/C18H15FN2O4/c19-13-7-6-12-10-15(17(22)20-16(12)11-13)18(23)21-25-9-8-24-14-4-2-1-3-5-14/h1-7,10-11H,8-9H2,(H,20,22)(H,21,23) |
| InChIKey | KZEXNEQMKXXKNM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|