C19H21FN2O4S — CID 110607539
N-[2-(4-fluorophenyl)-2-oxoethyl]-2-methyl-3-[(4-methylphenyl)sulfamoyl]propanamide (PubChem CID 110607539) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-oxoethyl]-2-methyl-3-[(4-methylphenyl)sulfamoyl]propanamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-oxoethyl]-2-methyl-3-[(4-methylphenyl)sulfamoyl]propanamide |
|---|---|
| PubChem CID | 110607539 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-oxoethyl]-2-methyl-3-[(4-methylphenyl)sulfamoyl]propanamide |
| SMILES | Cc1ccc(NS(=O)(=O)CC(C)C(=O)NCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-13-3-9-17(10-4-13)22-27(25,26)12-14(2)19(24)21-11-18(23)15-5-7-16(20)8-6-15/h3-10,14,22H,11-12H2,1-2H3,(H,21,24) |
| InChIKey | MLUAVDHDZZFWPN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |