C15H22F2N2O3S — CID 110674439
3-[(2,4-difluorophenyl)sulfamoyl]-2-methyl-N-(3-methylbutyl)propanamide (PubChem CID 110674439) has the molecular formula C15H22F2N2O3S and a molecular weight of 348.42 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)sulfamoyl]-2-methyl-N-(3-methylbutyl)propanamide.
| Compound Name | 3-[(2,4-difluorophenyl)sulfamoyl]-2-methyl-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 110674439 |
| Molecular Formula | C15H22F2N2O3S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[(2,4-difluorophenyl)sulfamoyl]-2-methyl-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)CS(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H22F2N2O3S/c1-10(2)6-7-18-15(20)11(3)9-23(21,22)19-14-5-4-12(16)8-13(14)17/h4-5,8,10-11,19H,6-7,9H2,1-3H3,(H,18,20) |
| InChIKey | RGWWMFQQOZGQIN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |