C13H20FN3O5S2 — CID 110631787
3-[(3-fluorophenyl)sulfamoyl]-2-methyl-N-[2-(methylsulfamoyl)ethyl]propanamide (PubChem CID 110631787) has the molecular formula C13H20FN3O5S2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfamoyl]-2-methyl-N-[2-(methylsulfamoyl)ethyl]propanamide.
| Compound Name | 3-[(3-fluorophenyl)sulfamoyl]-2-methyl-N-[2-(methylsulfamoyl)ethyl]propanamide |
|---|---|
| PubChem CID | 110631787 |
| Molecular Formula | C13H20FN3O5S2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfamoyl]-2-methyl-N-[2-(methylsulfamoyl)ethyl]propanamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C(C)CS(=O)(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H20FN3O5S2/c1-10(13(18)16-6-7-23(19,20)15-2)9-24(21,22)17-12-5-3-4-11(14)8-12/h3-5,8,10,15,17H,6-7,9H2,1-2H3,(H,16,18) |
| InChIKey | OSDMXFZZJRXNFB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |