C15H23FN2O4S — CID 110610179
3-[(3-fluorophenyl)sulfamoyl]-N-(4-methoxybutyl)-2-methylpropanamide (PubChem CID 110610179) has the molecular formula C15H23FN2O4S and a molecular weight of 346.42 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfamoyl]-N-(4-methoxybutyl)-2-methylpropanamide.
| Compound Name | 3-[(3-fluorophenyl)sulfamoyl]-N-(4-methoxybutyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 110610179 |
| Molecular Formula | C15H23FN2O4S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfamoyl]-N-(4-methoxybutyl)-2-methylpropanamide |
| SMILES | COCCCCNC(=O)C(C)CS(=O)(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H23FN2O4S/c1-12(15(19)17-8-3-4-9-22-2)11-23(20,21)18-14-7-5-6-13(16)10-14/h5-7,10,12,18H,3-4,8-9,11H2,1-2H3,(H,17,19) |
| InChIKey | FULYJNRADJOOAN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|