C17H18F2N2O4S — CID 110428867
N-(2,6-difluorophenyl)-3-[(3-methoxyphenyl)sulfamoyl]-2-methylpropanamide (PubChem CID 110428867) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-[(3-methoxyphenyl)sulfamoyl]-2-methylpropanamide.
| Compound Name | N-(2,6-difluorophenyl)-3-[(3-methoxyphenyl)sulfamoyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110428867 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-[(3-methoxyphenyl)sulfamoyl]-2-methylpropanamide |
| SMILES | COc1cccc(NS(=O)(=O)CC(C)C(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C17H18F2N2O4S/c1-11(17(22)20-16-14(18)7-4-8-15(16)19)10-26(23,24)21-12-5-3-6-13(9-12)25-2/h3-9,11,21H,10H2,1-2H3,(H,20,22) |
| InChIKey | NPYWOWRBSGWSOD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |