C10H13N3O4S — CID 110608285
6-(ethylsulfamoylamino)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 110608285) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 6-(ethylsulfamoylamino)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(ethylsulfamoylamino)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110608285 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 6-(ethylsulfamoylamino)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCNS(=O)(=O)Nc1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C10H13N3O4S/c1-3-11-18(15,16)12-7-4-5-8-9(6-7)17-10(14)13(8)2/h4-6,11-12H,3H2,1-2H3 |
| InChIKey | OMEBGIDVXCRRSD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |