C17H26N4O2S — CID 110608436
4-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpiperazine-1-sulfonamide (PubChem CID 110608436) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpiperazine-1-sulfonamide.
| Compound Name | 4-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 110608436 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpiperazine-1-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)N1CCN(CCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-14(2)19-24(22,23)21-11-9-20(10-12-21)8-7-15-13-18-17-6-4-3-5-16(15)17/h3-6,13-14,18-19H,7-12H2,1-2H3 |
| InChIKey | RTVXHNCSOJLKGB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |