C22H27N3O2S — CID 113074456
3-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]ethyl]-1H-indole (PubChem CID 113074456) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 3-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]ethyl]-1H-indole.
| Compound Name | 3-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 113074456 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]ethyl]-1H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCc3c[nH]c4ccccc34)CC2)c(C)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-17-7-8-22(18(2)15-17)28(26,27)25-13-11-24(12-14-25)10-9-19-16-23-21-6-4-3-5-20(19)21/h3-8,15-16,23H,9-14H2,1-2H3 |
| InChIKey | VKECRWHFRHDBJC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |