C20H30N2O4 — CID 110608558
3-(1,3-benzodioxol-5-yl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]propan-1-one (PubChem CID 110608558) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110608558 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]propan-1-one |
| SMILES | COCCCN1C(C)CN(C(=O)CCc2ccc3c(c2)OCO3)CC1C |
| InChI | InChI=1S/C20H30N2O4/c1-15-12-21(13-16(2)22(15)9-4-10-24-3)20(23)8-6-17-5-7-18-19(11-17)26-14-25-18/h5,7,11,15-16H,4,6,8-10,12-14H2,1-3H3 |
| InChIKey | VWTYEZRNTZELOU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|